| MolName | (15S,19R)-17-[(Z)-(3-hydroxyphenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| MolecularFormula | C25H18N2O3 |
| Smiles | Oc1cccc(/C=N\N(C([C@H]([C@H]2C3c4c5cccc4)C5c4c3cccc4)=O)C2=O)c1 |
| InChI | InChI=1S/C25H18N2O3/c28-15-7-5-6-14(12-15)13-26-27-24(29)22-20-16-8-1-2-9-17(16)21(23(22)25(27)30)19-11-4-3-10-18(19)20/h1-13,20-23,28H/t20?,21?,22-,23-/m1/s1 |
| InChIK | LNKGIOGBYYJFHT-BWWMBTDCSA-N |
| TotalMolweight | 394.429 |
| Molweight | 394.429 |
| MonoisotopicMass | 394.131743 |
| CLogP | 2.7572 |
| CLogS | -4.834 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 279.19 |
| Relative PSA | 0.19428 |
| PolarSurfaceArea | 69.97 |
| Druglikeness | 4.7849 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.43333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 2 |
| Rotatable Bond | 2 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| StereoCon | meso |
Click to Load Molecule:
1 - (15S,19R)-17-[(Z)-(3-hydroxyphenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione | 2 - (15S,19R)-17-[(Z)-(3-hydroxyphenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione