| MolName | N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-hydroxy-2-phenylacetamide |
| MolecularFormula | C13H10N2O3Br2 |
| Smiles | OC(C(N/N=C\c(o1)cc(Br)c1Br)=O)c1ccccc1 |
| InChI | InChI=1S/C13H10Br2N2O3/c14-10-6-9(20-12(10)15)7-16-17-13(19)11(18)8-4-2-1-3-5-8/h1-7,11,18H,(H,17,19)/t11-/m1/s1 |
| InChIK | LNOBHEDZTQNYJT-LLVKDONJSA-N |
| TotalMolweight | 402.041 |
| Molweight | 402.041 |
| MonoisotopicMass | 399.905815 |
| CLogP | 2.8661 |
| CLogS | -4.251 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 232.79 |
| Relative PSA | 0.27158 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | -0.0602 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-hydroxy-2-phenylacetamide | 2 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-hydroxy-2-phenylacetamide