| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| MolecularFormula | C20H16N6O2Cl2S3 |
| Smiles | O=C(CSc1nnc(SCC(N/N=C\c(cc2)ccc2Cl)=O)s1)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C20H16Cl2N6O2S3/c21-15-5-1-13(2-6-15)9-23-25-17(29)11-31-19-27-28-20(33-19)32-12-18(30)26-24-10-14-3-7-16(22)8-4-14/h1-10H,11-12H2,(H,25,29)(H,26,30) |
| InChIK | LNQGVHWOJWVAMH-UHFFFAOYSA-N |
| TotalMolweight | 539.491 |
| Molweight | 539.491 |
| MonoisotopicMass | 537.987388 |
| CLogP | 5.4184 |
| CLogS | -8.03 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 387.52 |
| Relative PSA | 0.38527 |
| PolarSurfaceArea | 187.54 |
| Druglikeness | 5.15 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75758 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 18 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide