| MolName | 1-(1-adamantyl)-3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]urea |
| MolecularFormula | C16H20N4O3S |
| Smiles | [O-][N+](c1ccc(/C=N\NC(NC2(CC(C3)C4)CC4CC3C2)=O)s1)=O |
| InChI | InChI=1S/C16H20N4O3S/c21-15(19-17-9-13-1-2-14(24-13)20(22)23)18-16-6-10-3-11(7-16)5-12(4-10)8-16/h1-2,9-12H,3-8H2,(H2,18,19,21) |
| InChIK | LNRNBAZOSCEDNG-UHFFFAOYSA-N |
| TotalMolweight | 348.426 |
| Molweight | 348.426 |
| MonoisotopicMass | 348.125611 |
| CLogP | 2.6966 |
| CLogS | -5.685 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 248.27 |
| Relative PSA | 0.39574 |
| PolarSurfaceArea | 127.55 |
| Druglikeness | 0.79292 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(1-adamantyl)-3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]urea | 2 - 1-(1-adamantyl)-3-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]urea