| MolName | 2-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C31H36N4O |
| Smiles | O=C(CN1[C@@H](CCC2)c3c2c(cc(C2CCCCC2)cc2)c2n3CC1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C31H36N4O/c36-30(33-32-18-8-11-23-9-3-1-4-10-23)22-34-19-20-35-28-17-16-25(24-12-5-2-6-13-24)21-27(28)26-14-7-15-29(34)31(26)35/h1,3-4,8-11,16-18,21,24,29H,2,5-7,12-15,19-20,22H2,(H,33,36)/t29-/m0/s1 |
| InChIK | LOCLHXKYHXMWRG-LJAQVGFWSA-N |
| TotalMolweight | 480.654 |
| Molweight | 480.654 |
| MonoisotopicMass | 480.288911 |
| CLogP | 6.611 |
| CLogS | -5.779 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 383.45 |
| Relative PSA | 0.12108 |
| PolarSurfaceArea | 49.63 |
| Druglikeness | 2.0568 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 14 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide