| MolName | N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]benzamide |
| MolecularFormula | C25H22N4O |
| Smiles | O=C(c(cc1)ccc1N/N=C\C=C\c1ccccc1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C25H22N4O/c30-25(29-27-20-8-14-22-11-5-2-6-12-22)23-15-17-24(18-16-23)28-26-19-7-13-21-9-3-1-4-10-21/h1-20,28H,(H,29,30) |
| InChIK | LOEBDRRZEVYEBP-UHFFFAOYSA-N |
| TotalMolweight | 394.477 |
| Molweight | 394.477 |
| MonoisotopicMass | 394.179361 |
| CLogP | 6.4195 |
| CLogS | -5.838 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 335.97 |
| Relative PSA | 0.17555 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 4.4481 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]benzamide | 2 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]benzamide