| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(2-phenylethylsulfanyl)acetamide |
| MolecularFormula | C17H16N2OCl2S |
| Smiles | O=C(CSCCc1ccccc1)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2OS/c18-15-7-4-8-16(19)14(15)11-20-21-17(22)12-23-10-9-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,21,22) |
| InChIK | LOGLZKPMQPCXIP-UHFFFAOYSA-N |
| TotalMolweight | 367.299 |
| Molweight | 367.299 |
| MonoisotopicMass | 366.036037 |
| CLogP | 5.0579 |
| CLogS | -5.765 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 276.6 |
| Relative PSA | 0.19342 |
| PolarSurfaceArea | 66.76 |
| Druglikeness | 4.3994 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(2-phenylethylsulfanyl)acetamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-(2-phenylethylsulfanyl)acetamide