| MolName | 1-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| MolecularFormula | C18H21N4O2BrS |
| Smiles | S=C(NCCN1CCOCC1)N/N=C\c1ccc(-c(cccc2)c2Br)o1 |
| InChI | InChI=1S/C18H21BrN4O2S/c19-16-4-2-1-3-15(16)17-6-5-14(25-17)13-21-22-18(26)20-7-8-23-9-11-24-12-10-23/h1-6,13H,7-12H2,(H2,20,22,26) |
| InChIK | LPGGNWLYSUHQPS-UHFFFAOYSA-N |
| TotalMolweight | 437.361 |
| Molweight | 437.361 |
| MonoisotopicMass | 436.056857 |
| CLogP | 3.2164 |
| CLogS | -4.598 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 311.09 |
| Relative PSA | 0.28959 |
| PolarSurfaceArea | 94.12 |
| Druglikeness | 4.4064 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea | 2 - 1-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea