| MolName | (2R,8S)-2-phenyl-6-[(Z)-pyridin-4-ylmethylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| MolecularFormula | C26H21N5O2 |
| Smiles | O=C(CN(C([C@@H]1Cc2c3[nH]c4c2cccc4)=O)/N=C\c2ccncc2)N1[C@@H]3c1ccccc1 |
| InChI | InChI=1S/C26H21N5O2/c32-23-16-30(28-15-17-10-12-27-13-11-17)26(33)22-14-20-19-8-4-5-9-21(19)29-24(20)25(31(22)23)18-6-2-1-3-7-18/h1-13,15,22,25,29H,14,16H2/t22-,25+/m0/s1 |
| InChIK | LPMDKAJXZNVCJP-WIOPSUGQSA-N |
| TotalMolweight | 435.486 |
| Molweight | 435.486 |
| MonoisotopicMass | 435.169525 |
| CLogP | 2.9418 |
| CLogS | -4.061 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 322.09 |
| Relative PSA | 0.21624 |
| PolarSurfaceArea | 81.66 |
| Druglikeness | 7.2432 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 2 |
| Rotatable Bond | 3 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2R,8S)-2-phenyl-6-[(Z)-pyridin-4-ylmethylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione | 2 - (2R,8S)-2-phenyl-6-[(Z)-pyridin-4-ylmethylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione