| MolName | [(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]urea |
| MolecularFormula | C19H17N3O2 |
| Smiles | NC(N/N=C\c1cc(OCc2cccc3ccccc23)ccc1)=O |
| InChI | InChI=1S/C19H17N3O2/c20-19(23)22-21-12-14-5-3-9-17(11-14)24-13-16-8-4-7-15-6-1-2-10-18(15)16/h1-12H,13H2,(H3,20,22,23) |
| InChIK | LQKMURIICAUEIO-UHFFFAOYSA-N |
| TotalMolweight | 319.363 |
| Molweight | 319.363 |
| MonoisotopicMass | 319.132077 |
| CLogP | 3.6778 |
| CLogS | -5.761 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 253.87 |
| Relative PSA | 0.24138 |
| PolarSurfaceArea | 76.71 |
| Druglikeness | 3.8906 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]urea | 2 - [(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]urea