| MolName | (Z)-1-[(3Z)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]methanimine |
| MolecularFormula | C24H23N5O5 |
| Smiles | [O-][N+](c1ccc(/C=N\N=C/C(CC/C2=C/c3cccc([N+]([O-])=O)c3)=C2N2CCOCC2)cc1)=O |
| InChI | InChI=1S/C24H23N5O5/c30-28(31)22-8-4-18(5-9-22)16-25-26-17-21-7-6-20(24(21)27-10-12-34-13-11-27)14-19-2-1-3-23(15-19)29(32)33/h1-5,8-9,14-17H,6-7,10-13H2 |
| InChIK | LQMGJLCOVVQEIM-UHFFFAOYSA-N |
| TotalMolweight | 461.477 |
| Molweight | 461.477 |
| MonoisotopicMass | 461.16992 |
| CLogP | 3.5219 |
| CLogS | -5.618 |
| H Acceptors | 10 |
| TotalSurfaceArea | 353.37 |
| Relative PSA | 0.27566 |
| PolarSurfaceArea | 128.83 |
| Druglikeness | -2.277 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[(3Z)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]methanimine | 2 - (Z)-1-[(3Z)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]-N-[(Z)-(4-nitrophenyl)methylideneamino]methanimine