| MolName | N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| MolecularFormula | C17H17N4OBr |
| Smiles | O=C(c1n[nH]c2c1CCCC2)N/N=C/C(/Br)=C/c1ccccc1 |
| InChI | InChI=1S/C17H17BrN4O/c18-13(10-12-6-2-1-3-7-12)11-19-22-17(23)16-14-8-4-5-9-15(14)20-21-16/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,21)(H,22,23) |
| InChIK | LQPJMDORWTWCGP-UHFFFAOYSA-N |
| TotalMolweight | 373.253 |
| Molweight | 373.253 |
| MonoisotopicMass | 372.058572 |
| CLogP | 2.9709 |
| CLogS | -4.559 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 260.2 |
| Relative PSA | 0.23432 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | -4.0917 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide | 2 - N-[(E)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide