2-[2-[(Z)-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid
Formula:C20H17N4O4ClS3
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
2-[2-[(Z)-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid is not a drug-like molecule.
| MolName | 2-[2-[(Z)-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C20H17N4O4ClS3 |
| Smiles | OC(COc1c(/C=N\NC(CSc2nnc(SCc(cccc3)c3Cl)s2)=O)cccc1)=O |
| InChI | InChI=1S/C20H17ClN4O4S3/c21-15-7-3-1-6-14(15)11-30-19-24-25-20(32-19)31-12-17(26)23-22-9-13-5-2-4-8-16(13)29-10-18(27)28/h1-9H,10-12H2,(H,23,26)(H,27,28) |
| InChIK | LRHNRHGBOCURQB-UHFFFAOYSA-N |
| TotalMolweight | 509.03 |
| Molweight | 509.03 |
| MonoisotopicMass | 508.010043 |
| CLogP | 4.079 |
| CLogS | -6.869 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 365.99 |
| Relative PSA | 0.40829 |
| PolarSurfaceArea | 192.61 |
| Druglikeness | 5.0408 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off