| MolName | 4-(2-anilino-2-oxoethoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzamide |
| MolecularFormula | C22H17N3O3Cl2 |
| Smiles | O=C(COc(cc1)ccc1C(N/N=C\c(cc1)cc(Cl)c1Cl)=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H17Cl2N3O3/c23-19-11-6-15(12-20(19)24)13-25-27-22(29)16-7-9-18(10-8-16)30-14-21(28)26-17-4-2-1-3-5-17/h1-13H,14H2,(H,26,28)(H,27,29) |
| InChIK | LRQAUPPAKSUGRD-UHFFFAOYSA-N |
| TotalMolweight | 442.301 |
| Molweight | 442.301 |
| MonoisotopicMass | 441.064696 |
| CLogP | 5.136 |
| CLogS | -6.485 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 330.56 |
| Relative PSA | 0.2133 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 4.7007 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2-anilino-2-oxoethoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzamide | 2 - 4-(2-anilino-2-oxoethoxy)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzamide