| MolName | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| MolecularFormula | C24H20N4O2Cl2S2 |
| Smiles | O=C(CSc(cc1)ccc1Cl)N/N=C\c1ccc(/C=N\NC(CSc(cc2)ccc2Cl)=O)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O2S2/c25-19-5-9-21(10-6-19)33-15-23(31)29-27-13-17-1-2-18(4-3-17)14-28-30-24(32)16-34-22-11-7-20(26)8-12-22/h1-14H,15-16H2,(H,29,31)(H,30,32) |
| InChIK | LRSQKNAWTBKKPG-UHFFFAOYSA-N |
| TotalMolweight | 531.487 |
| Molweight | 531.487 |
| MonoisotopicMass | 530.04047 |
| CLogP | 6.3812 |
| CLogS | -8.382 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 394.06 |
| Relative PSA | 0.27153 |
| PolarSurfaceArea | 133.52 |
| Druglikeness | 4.8128 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76471 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 20 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide | 2 - 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide