| MolName | (2R)-2-hydroxy-N-[(Z)-[(2Z)-2-[[(2S)-2-hydroxy-2-phenylacetyl]hydrazinylidene]ethylidene]amino]-2-phenylacetamide |
| MolecularFormula | C18H18N4O4 |
| Smiles | O[C@H](C(N/N=C\C=N/NC([C@@H](c1ccccc1)O)=O)=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O4/c23-15(13-7-3-1-4-8-13)17(25)21-19-11-12-20-22-18(26)16(24)14-9-5-2-6-10-14/h1-12,15-16,23-24H,(H,21,25)(H,22,26)/t15-,16+ |
| InChIK | LRXCPNWFUAREHP-IYBDPMFKSA-N |
| TotalMolweight | 354.365 |
| Molweight | 354.365 |
| MonoisotopicMass | 354.132806 |
| CLogP | -0.2274 |
| CLogS | -2.796 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 278.66 |
| Relative PSA | 0.35247 |
| PolarSurfaceArea | 123.38 |
| Druglikeness | 5.1443 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 2 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon | meso |
Click to Load Molecule:
1 - (2R)-2-hydroxy-N-[(Z)-[(2Z)-2-[[(2S)-2-hydroxy-2-phenylacetyl]hydrazinylidene]ethylidene]amino]-2-phenylacetamide | 2 - (2R)-2-hydroxy-N-[(Z)-[(2Z)-2-[[(2S)-2-hydroxy-2-phenylacetyl]hydrazinylidene]ethylidene]amino]-2-phenylacetamide