| MolName | [4-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| MolecularFormula | C28H21N3O5S |
| Smiles | O=C(/C=C/c1ccco1)Oc1ccc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c2cccs2)=O)cc1 |
| InChI | InChI=1S/C28H21N3O5S/c32-26(15-14-22-8-4-16-35-22)36-23-12-10-20(11-13-23)19-29-31-28(34)25(18-24-9-5-17-37-24)30-27(33)21-6-2-1-3-7-21/h1-19H,(H,30,33)(H,31,34) |
| InChIK | LRYJMHKNAKUVLE-UHFFFAOYSA-N |
| TotalMolweight | 511.557 |
| Molweight | 511.557 |
| MonoisotopicMass | 511.120192 |
| CLogP | 5.6333 |
| CLogS | -6.998 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 400.31 |
| Relative PSA | 0.29482 |
| PolarSurfaceArea | 138.24 |
| Druglikeness | 4.851 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59459 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate | 2 - [4-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate