| MolName | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| MolecularFormula | C18H18N4O6F2S |
| Smiles | [O-][N+](c(cc(cc1)S(N2CCOCC2)(=O)=O)c1N/N=C\c(cccc1)c1OC(F)F)=O |
| InChI | InChI=1S/C18H18F2N4O6S/c19-18(20)30-17-4-2-1-3-13(17)12-21-22-15-6-5-14(11-16(15)24(25)26)31(27,28)23-7-9-29-10-8-23/h1-6,11-12,18,22H,7-10H2 |
| InChIK | LRYKPYRWQWJHNH-UHFFFAOYSA-N |
| TotalMolweight | 456.425 |
| Molweight | 456.425 |
| MonoisotopicMass | 456.091512 |
| CLogP | 3.1315 |
| CLogS | -3.437 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 318.53 |
| Relative PSA | 0.33127 |
| PolarSurfaceArea | 134.43 |
| Druglikeness | -6.8551 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline | 2 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-morpholin-4-ylsulfonyl-2-nitroaniline