| MolName | 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C21H15N4OClS2 |
| Smiles | O=C(c(cc1)ccc1-c1csc(Nc(cc2)ccc2Cl)n1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C21H15ClN4OS2/c22-16-7-9-17(10-8-16)24-21-25-19(13-29-21)14-3-5-15(6-4-14)20(27)26-23-12-18-2-1-11-28-18/h1-13H,(H,24,25)(H,26,27) |
| InChIK | LSIPJBPMDMKSON-UHFFFAOYSA-N |
| TotalMolweight | 438.962 |
| Molweight | 438.962 |
| MonoisotopicMass | 438.037578 |
| CLogP | 6.5801 |
| CLogS | -7.556 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 324.03 |
| Relative PSA | 0.30602 |
| PolarSurfaceArea | 122.86 |
| Druglikeness | 6.9719 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide | 2 - 4-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide