| MolName | 5-[(Z)-[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonic acid |
| MolecularFormula | C13H12N2O5S |
| Smiles | OS(c1ccc(/C=N\NC(Cc2ccccc2)=O)o1)(=O)=O |
| InChI | InChI=1S/C13H12N2O5S/c16-12(8-10-4-2-1-3-5-10)15-14-9-11-6-7-13(20-11)21(17,18)19/h1-7,9H,8H2,(H,15,16)(H,17,18,19) |
| InChIK | LSIYMCBXRQZXFF-UHFFFAOYSA-N |
| TotalMolweight | 308.313 |
| Molweight | 308.313 |
| MonoisotopicMass | 308.046693 |
| CLogP | 0.2565 |
| CLogS | -1.737 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 225.37 |
| Relative PSA | 0.40733 |
| PolarSurfaceArea | 117.35 |
| Druglikeness | 5.9043 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonic acid | 2 - 5-[(Z)-[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonic acid