| MolName | N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-indole-3-carboxamide |
| MolecularFormula | C28H22N4O |
| Smiles | O=C(c1c[nH]c2c1cccc2)N/N=C\c(cc1)ccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O/c33-28(26-20-29-27-14-8-7-13-25(26)27)31-30-19-21-15-17-24(18-16-21)32(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-20,29H,(H,31,33) |
| InChIK | LSLXBCNBTBWURM-UHFFFAOYSA-N |
| TotalMolweight | 430.51 |
| Molweight | 430.51 |
| MonoisotopicMass | 430.179361 |
| CLogP | 5.8354 |
| CLogS | -8.422 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 340.98 |
| Relative PSA | 0.15705 |
| PolarSurfaceArea | 60.49 |
| Druglikeness | 6.0152 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Symmetricatoms | 10 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-indole-3-carboxamide | 2 - N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-indole-3-carboxamide