| MolName | N-[(Z)-(4-phenoxyphenyl)methylideneamino]thiophene-2-carboxamide |
| MolecularFormula | C18H14N2O2S |
| Smiles | O=C(c1cccs1)N/N=C\c(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C18H14N2O2S/c21-18(17-7-4-12-23-17)20-19-13-14-8-10-16(11-9-14)22-15-5-2-1-3-6-15/h1-13H,(H,20,21) |
| InChIK | LSPYZTWLRZGYRZ-UHFFFAOYSA-N |
| TotalMolweight | 322.387 |
| Molweight | 322.387 |
| MonoisotopicMass | 322.077598 |
| CLogP | 4.4638 |
| CLogS | -6.028 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 252.69 |
| Relative PSA | 0.26265 |
| PolarSurfaceArea | 78.93 |
| Druglikeness | 6.1106 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenoxyphenyl)methylideneamino]thiophene-2-carboxamide | 2 - N-[(Z)-(4-phenoxyphenyl)methylideneamino]thiophene-2-carboxamide