| MolName | 4-amino-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C17H11N6O5BrCl2 |
| Smiles | Nc1nonc1C(N/N=C\c1cc(Br)cc([N+]([O-])=O)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C17H11BrCl2N6O5/c18-10-3-9(6-22-23-17(27)14-16(21)25-31-24-14)15(13(4-10)26(28)29)30-7-8-1-2-11(19)5-12(8)20/h1-6H,7H2,(H2,21,25)(H,23,27) |
| InChIK | LSUUSDCVEJAQKG-UHFFFAOYSA-N |
| TotalMolweight | 530.121 |
| Molweight | 530.121 |
| MonoisotopicMass | 527.935134 |
| CLogP | 3.8047 |
| CLogS | -6.696 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 339.38 |
| Relative PSA | 0.37642 |
| PolarSurfaceArea | 161.45 |
| Druglikeness | -0.85665 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide