| MolName | 3-(3,4-dichlorophenyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C19H14N4OCl2 |
| Smiles | O=C(c1cc(-c(cc2)cc(Cl)c2Cl)n[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N4O/c20-15-9-8-14(11-16(15)21)17-12-18(24-23-17)19(26)25-22-10-4-7-13-5-2-1-3-6-13/h1-12H,(H,23,24)(H,25,26) |
| InChIK | LTLXAZMHCJHUNQ-UHFFFAOYSA-N |
| TotalMolweight | 385.253 |
| Molweight | 385.253 |
| MonoisotopicMass | 384.054465 |
| CLogP | 4.1297 |
| CLogS | -5.86 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 292.42 |
| Relative PSA | 0.2085 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 5.6552 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(3,4-dichlorophenyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide | 2 - 3-(3,4-dichlorophenyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide