| MolName | 2-[(2-chloro-4-nitrophenyl)carbamoylamino]-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H13N5O4ClF |
| Smiles | [O-][N+](c(cc1)cc(Cl)c1NC(NCC(N/N=C\c1cc(F)ccc1)=O)=O)=O |
| InChI | InChI=1S/C16H13ClFN5O4/c17-13-7-12(23(26)27)4-5-14(13)21-16(25)19-9-15(24)22-20-8-10-2-1-3-11(18)6-10/h1-8H,9H2,(H,22,24)(H2,19,21,25) |
| InChIK | LUEMMRXLCVKGOW-UHFFFAOYSA-N |
| TotalMolweight | 393.761 |
| Molweight | 393.761 |
| MonoisotopicMass | 393.06401 |
| CLogP | 2.0644 |
| CLogS | -5.514 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 286.86 |
| Relative PSA | 0.35693 |
| PolarSurfaceArea | 128.41 |
| Druglikeness | -0.91905 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Amides | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2-chloro-4-nitrophenyl)carbamoylamino]-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide | 2 - 2-[(2-chloro-4-nitrophenyl)carbamoylamino]-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide