| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-amine |
| MolecularFormula | C20H18N4O3Cl2S2 |
| Smiles | O=S(c1cccc(-c2csc(N/N=C\c(ccc(Cl)c3)c3Cl)n2)c1)(N1CCOCC1)=O |
| InChI | InChI=1S/C20H18Cl2N4O3S2/c21-16-5-4-15(18(22)11-16)12-23-25-20-24-19(13-30-20)14-2-1-3-17(10-14)31(27,28)26-6-8-29-9-7-26/h1-5,10-13H,6-9H2,(H,24,25) |
| InChIK | LUHWWWPTZWJHRC-UHFFFAOYSA-N |
| TotalMolweight | 497.426 |
| Molweight | 497.426 |
| MonoisotopicMass | 496.019735 |
| CLogP | 6.4712 |
| CLogS | -5.338 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 344.96 |
| Relative PSA | 0.27954 |
| PolarSurfaceArea | 120.51 |
| Druglikeness | 1.9414 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-amine | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-(3-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-amine