| MolName | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]acetamide |
| MolecularFormula | C21H14N5OBrCl2S2 |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1-c(cc1)ccc1Cl)N/N=C\c(s1)ccc1Br |
| InChI | InChI=1S/C21H14BrCl2N5OS2/c22-18-10-9-17(32-18)11-25-26-19(30)12-31-21-28-27-20(13-1-3-14(23)4-2-13)29(21)16-7-5-15(24)6-8-16/h1-11H,12H2,(H,26,30) |
| InChIK | LUNDIROMFLLHQC-UHFFFAOYSA-N |
| TotalMolweight | 567.318 |
| Molweight | 567.318 |
| MonoisotopicMass | 564.920015 |
| CLogP | 6.5403 |
| CLogS | -10.749 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 369.89 |
| Relative PSA | 0.27757 |
| PolarSurfaceArea | 125.71 |
| Druglikeness | 3.0395 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]acetamide | 2 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]acetamide