| MolName | 5-[(Z)-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)iminomethyl]furan-2-sulfonate |
| MolecularFormula | C15H8N4O5BrS |
| Smiles | [O-]S(c1ccc(/C=N\N(C=Nc2c3[nH]c(cc4)c2cc4Br)C3=O)o1)(=O)=O |
| InChI | InChI=1S/C15H9BrN4O5S/c16-8-1-3-11-10(5-8)13-14(19-11)15(21)20(7-17-13)18-6-9-2-4-12(25-9)26(22,23)24/h1-7,19H,(H,22,23,24)/p-1 |
| InChIK | LUNMBIYKAOJIGS-UHFFFAOYSA-M |
| TotalMolweight | 436.222 |
| Molweight | 436.222 |
| MonoisotopicMass | 434.939877 |
| CLogP | -0.9002 |
| CLogS | -3.233 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 265.69 |
| Relative PSA | 0.41616 |
| PolarSurfaceArea | 139.54 |
| Druglikeness | -0.60582 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 2 |
| Symmetricatoms | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)iminomethyl]furan-2-sulfonate | 2 - 5-[(Z)-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)iminomethyl]furan-2-sulfonate