| MolName | 6-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1H-pyrimidin-2-one |
| MolecularFormula | C9H8N4O2 |
| Smiles | O=C1N=CC=C(N/N=C\c2ccco2)N1 |
| InChI | InChI=1S/C9H8N4O2/c14-9-10-4-3-8(12-9)13-11-6-7-2-1-5-15-7/h1-6H,(H2,10,12,13,14) |
| InChIK | LUNVCXKQESJGPH-UHFFFAOYSA-N |
| TotalMolweight | 204.189 |
| Molweight | 204.189 |
| MonoisotopicMass | 204.064726 |
| CLogP | 1.0767 |
| CLogS | -4.314 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 164.35 |
| Relative PSA | 0.44472 |
| PolarSurfaceArea | 78.99 |
| Druglikeness | 2.8517 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | low |
| Nasty Functions | polar activated DB; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Amides | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1H-pyrimidin-2-one | 2 - 6-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1H-pyrimidin-2-one