| MolName | 3-amino-N-[(Z)-[(Z)-3-bromo-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-carboxamide |
| MolecularFormula | C12H11N6OBr |
| Smiles | Nc1n[nH]c(C(N/N=C\C=C(\c2ccccc2)/Br)=O)n1 |
| InChI | InChI=1S/C12H11BrN6O/c13-9(8-4-2-1-3-5-8)6-7-15-18-11(20)10-16-12(14)19-17-10/h1-7H,(H,18,20)(H3,14,16,17,19) |
| InChIK | LUSWKGGDNGNXER-UHFFFAOYSA-N |
| TotalMolweight | 335.164 |
| Molweight | 335.164 |
| MonoisotopicMass | 334.01777 |
| CLogP | 0.9812 |
| CLogS | -1.885 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 225.94 |
| Relative PSA | 0.38599 |
| PolarSurfaceArea | 109.05 |
| Druglikeness | 0.56443 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-amino-N-[(Z)-[(Z)-3-bromo-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-carboxamide | 2 - 3-amino-N-[(Z)-[(Z)-3-bromo-3-phenylprop-2-enylidene]amino]-1H-1,2,4-triazole-5-carboxamide