| MolName | 3-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline |
| MolecularFormula | C14H10N4O6 |
| Smiles | [O-][N+](c1cccc(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)c1)=O |
| InChI | InChI=1S/C14H10N4O6/c19-17(20)11-3-1-2-10(5-11)16-15-7-9-4-13-14(24-8-23-13)6-12(9)18(21)22/h1-7,16H,8H2 |
| InChIK | LVALUHDXCQCPDC-UHFFFAOYSA-N |
| TotalMolweight | 330.255 |
| Molweight | 330.255 |
| MonoisotopicMass | 330.060036 |
| CLogP | 3.1091 |
| CLogS | -4.78 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 236.84 |
| Relative PSA | 0.43831 |
| PolarSurfaceArea | 134.49 |
| Druglikeness | -3.3425 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline | 2 - 3-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline