| MolName | 4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzamide |
| MolecularFormula | C22H21N4O4BrS2 |
| Smiles | O=C(c(cc1)ccc1NS(c(cc1)ccc1Br)(=O)=O)N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C22H21BrN4O4S2/c23-17-3-8-20(9-4-17)33(29,30)26-18-5-1-16(2-6-18)22(28)25-24-15-19-7-10-21(32-19)27-11-13-31-14-12-27/h1-10,15,26H,11-14H2,(H,25,28) |
| InChIK | LVRDOHDTLVOZCP-UHFFFAOYSA-N |
| TotalMolweight | 549.469 |
| Molweight | 549.469 |
| MonoisotopicMass | 548.018757 |
| CLogP | 3.9511 |
| CLogS | -6.151 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 363.2 |
| Relative PSA | 0.30275 |
| PolarSurfaceArea | 136.72 |
| Druglikeness | 6.0489 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzamide | 2 - 4-[(4-bromophenyl)sulfonylamino]-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzamide