| MolName | (2E)-1,2-diphenyl-2-[(Z)-(4-phenylmethoxyphenyl)methylidenehydrazinylidene]ethanone |
| MolecularFormula | C28H22N2O2 |
| Smiles | O=C(/C(/c1ccccc1)=N/N=C\c(cc1)ccc1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N2O2/c31-28(25-14-8-3-9-15-25)27(24-12-6-2-7-13-24)30-29-20-22-16-18-26(19-17-22)32-21-23-10-4-1-5-11-23/h1-20H,21H2 |
| InChIK | LVYVQTLHCDZDMR-UHFFFAOYSA-N |
| TotalMolweight | 418.495 |
| Molweight | 418.495 |
| MonoisotopicMass | 418.168128 |
| CLogP | 6.6252 |
| CLogS | -7.149 |
| H Acceptors | 4 |
| TotalSurfaceArea | 341.78 |
| Relative PSA | 0.13477 |
| PolarSurfaceArea | 51.02 |
| Druglikeness | 2.376 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-1,2-diphenyl-2-[(Z)-(4-phenylmethoxyphenyl)methylidenehydrazinylidene]ethanone | 2 - (2E)-1,2-diphenyl-2-[(Z)-(4-phenylmethoxyphenyl)methylidenehydrazinylidene]ethanone