| MolName | N-(2-chlorophenyl)-2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| MolecularFormula | C19H13N4O4Cl3S |
| Smiles | [O-][N+](c(cc1)cc(S(Nc(cccc2)c2Cl)(=O)=O)c1N/N=C\c(c(Cl)ccc1)c1Cl)=O |
| InChI | InChI=1S/C19H13Cl3N4O4S/c20-14-5-3-6-15(21)13(14)11-23-24-18-9-8-12(26(27)28)10-19(18)31(29,30)25-17-7-2-1-4-16(17)22/h1-11,24-25H |
| InChIK | LWCVYRWUUGUXBN-UHFFFAOYSA-N |
| TotalMolweight | 499.761 |
| Molweight | 499.761 |
| MonoisotopicMass | 497.972307 |
| CLogP | 6.0364 |
| CLogS | -7.15 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 338.97 |
| Relative PSA | 0.27563 |
| PolarSurfaceArea | 124.76 |
| Druglikeness | -1.8002 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-chlorophenyl)-2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide | 2 - N-(2-chlorophenyl)-2-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide