| MolName | 1-[(Z)-(2-bromophenyl)methylideneamino]tetrazol-5-amine |
| MolecularFormula | C8H7N6Br |
| Smiles | Nc1nnnn1/N=C\c(cccc1)c1Br |
| InChI | InChI=1S/C8H7BrN6/c9-7-4-2-1-3-6(7)5-11-15-8(10)12-13-14-15/h1-5H,(H2,10,12,14) |
| InChIK | LWGQOMXFJHCIIC-UHFFFAOYSA-N |
| TotalMolweight | 267.09 |
| Molweight | 267.09 |
| MonoisotopicMass | 265.991555 |
| CLogP | 1.9517 |
| CLogS | -4.621 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 170.41 |
| Relative PSA | 0.39059 |
| PolarSurfaceArea | 81.98 |
| Druglikeness | -0.3975 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(2-bromophenyl)methylideneamino]tetrazol-5-amine | 2 - 1-[(Z)-(2-bromophenyl)methylideneamino]tetrazol-5-amine