| MolName | 4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate |
| MolecularFormula | C15H10N3O5Cl2 |
| Smiles | [O-]c(ccc(/C=N\NC(COc(ccc(Cl)c1)c1Cl)=O)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C15H11Cl2N3O5/c16-10-2-4-14(11(17)6-10)25-8-15(22)19-18-7-9-1-3-13(21)12(5-9)20(23)24/h1-7,21H,8H2,(H,19,22)/p-1 |
| InChIK | LWPHQWMHYOBRIU-UHFFFAOYSA-M |
| TotalMolweight | 383.166 |
| Molweight | 383.166 |
| MonoisotopicMass | 381.999751 |
| CLogP | 1.1432 |
| CLogS | -5.137 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 272.79 |
| Relative PSA | 0.33253 |
| PolarSurfaceArea | 119.57 |
| Druglikeness | -0.88795 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate | 2 - 4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate