| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetamide |
| MolecularFormula | C16H11N6OCl3 |
| Smiles | O=C(Cn1nnc(-c2cccc(Cl)c2Cl)n1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C16H11Cl3N6O/c17-12-6-2-1-4-10(12)8-20-21-14(26)9-25-23-16(22-24-25)11-5-3-7-13(18)15(11)19/h1-8H,9H2,(H,21,26) |
| InChIK | LWUSLENHQYWWKO-UHFFFAOYSA-N |
| TotalMolweight | 409.663 |
| Molweight | 409.663 |
| MonoisotopicMass | 408.00599 |
| CLogP | 4.3309 |
| CLogS | -5.997 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 292.25 |
| Relative PSA | 0.25933 |
| PolarSurfaceArea | 85.06 |
| Druglikeness | 1.052 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetamide