| MolName | N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C22H14N6O4Cl2S |
| Smiles | [O-][N+](c(cc(/C=N\NC(c(cccc1)c1O)=O)cc1)c1Sc1n[nH]c(-c(ccc(Cl)c2)c2Cl)n1)=O |
| InChI | InChI=1S/C22H14Cl2N6O4S/c23-13-6-7-14(16(24)10-13)20-26-22(29-27-20)35-19-8-5-12(9-17(19)30(33)34)11-25-28-21(32)15-3-1-2-4-18(15)31/h1-11,31H,(H,28,32)(H,26,27,29) |
| InChIK | LXFWXLCVZRSCJP-UHFFFAOYSA-N |
| TotalMolweight | 529.363 |
| Molweight | 529.363 |
| MonoisotopicMass | 528.017428 |
| CLogP | 4.6224 |
| CLogS | -8.007 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 371.95 |
| Relative PSA | 0.35744 |
| PolarSurfaceArea | 174.38 |
| Druglikeness | -0.41143 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-2-hydroxybenzamide