| MolName | (Z)-N-cyclopropyl-4-[4-(difluoromethoxy)phenyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine |
| MolecularFormula | C24H24N4O2F2S |
| Smiles | FC(Oc(cc1)ccc1C(N1/N=C\c(cc2)ccc2N2CCOCC2)=CS/C1=N\C1CC1)F |
| InChI | InChI=1S/C24H24F2N4O2S/c25-23(26)32-21-9-3-18(4-10-21)22-16-33-24(28-19-5-6-19)30(22)27-15-17-1-7-20(8-2-17)29-11-13-31-14-12-29/h1-4,7-10,15-16,19,23H,5-6,11-14H2 |
| InChIK | LXNYVVBSLFANCC-UHFFFAOYSA-N |
| TotalMolweight | 470.543 |
| Molweight | 470.543 |
| MonoisotopicMass | 470.158802 |
| CLogP | 4.4181 |
| CLogS | -5.961 |
| H Acceptors | 6 |
| TotalSurfaceArea | 343.31 |
| Relative PSA | 0.19694 |
| PolarSurfaceArea | 74.96 |
| Druglikeness | 1.9777 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 8 |
| Amines | 1 |
| Aromatic Amines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-cyclopropyl-4-[4-(difluoromethoxy)phenyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine | 2 - (Z)-N-cyclopropyl-4-[4-(difluoromethoxy)phenyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-2-imine