| MolName | 2-hydroxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide |
| MolecularFormula | C18H19N3O3 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(cc1)ccc1N1CCOCC1)=O |
| InChI | InChI=1S/C18H19N3O3/c22-17-4-2-1-3-16(17)18(23)20-19-13-14-5-7-15(8-6-14)21-9-11-24-12-10-21/h1-8,13,22H,9-12H2,(H,20,23) |
| InChIK | LXSUZVUZPCIEMW-UHFFFAOYSA-N |
| TotalMolweight | 325.367 |
| Molweight | 325.367 |
| MonoisotopicMass | 325.142642 |
| CLogP | 2.5249 |
| CLogS | -3.528 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 255.18 |
| Relative PSA | 0.24555 |
| PolarSurfaceArea | 74.16 |
| Druglikeness | 5.0983 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide