| MolName | 3-[(4-chlorophenyl)methyl]-4-[(Z)-[(4Z)-4-[[3-[(4-chlorophenyl)methyl]-5-oxo-1H-1,2,4-triazol-4-yl]imino]butylidene]amino]-1H-1,2,4-triazol-5-one |
| MolecularFormula | C22H20N8O2Cl2 |
| Smiles | O=C(NN=C1Cc(cc2)ccc2Cl)N1/N=C\CC/C=N\N(C(Cc(cc1)ccc1Cl)=NN1)C1=O |
| InChI | InChI=1S/C22H20Cl2N8O2/c23-17-7-3-15(4-8-17)13-19-27-29-21(33)31(19)25-11-1-2-12-26-32-20(28-30-22(32)34)14-16-5-9-18(24)10-6-16/h3-12H,1-2,13-14H2,(H,29,33)(H,30,34) |
| InChIK | LYDYHYVCXLUSEP-UHFFFAOYSA-N |
| TotalMolweight | 499.361 |
| Molweight | 499.361 |
| MonoisotopicMass | 498.108626 |
| CLogP | 3.55 |
| CLogS | -7.196 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 366.38 |
| Relative PSA | 0.27878 |
| PolarSurfaceArea | 114.12 |
| Druglikeness | 3.5936 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)methyl]-4-[(Z)-[(4Z)-4-[[3-[(4-chlorophenyl)methyl]-5-oxo-1H-1,2,4-triazol-4-yl]imino]butylidene]amino]-1H-1,2,4-triazol-5-one | 2 - 3-[(4-chlorophenyl)methyl]-4-[(Z)-[(4Z)-4-[[3-[(4-chlorophenyl)methyl]-5-oxo-1H-1,2,4-triazol-4-yl]imino]butylidene]amino]-1H-1,2,4-triazol-5-one