| MolName | 2-[(Z)-2-phenylsulfanylethylideneamino]guanidine |
| MolecularFormula | C9H12N4S |
| Smiles | NC(N)=N/N=C\CSc1ccccc1 |
| InChI | InChI=1S/C9H12N4S/c10-9(11)13-12-6-7-14-8-4-2-1-3-5-8/h1-6H,7H2,(H4,10,11,13) |
| InChIK | LYIBHDAMYQOXNS-UHFFFAOYSA-N |
| TotalMolweight | 208.288 |
| Molweight | 208.288 |
| MonoisotopicMass | 208.078266 |
| CLogP | 1.7752 |
| CLogS | -3.454 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 169.28 |
| Relative PSA | 0.41972 |
| PolarSurfaceArea | 102.06 |
| Druglikeness | 1.9269 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.78571 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-2-phenylsulfanylethylideneamino]guanidine | 2 - 2-[(Z)-2-phenylsulfanylethylideneamino]guanidine