| MolName | 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea |
| MolecularFormula | C20H21N5O5S2 |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(Nc(cc2)ccc2S(N2CCOCC2)(=O)=O)=S)cccc1)=O |
| InChI | InChI=1S/C20H21N5O5S2/c26-25(27)19-6-2-1-4-16(19)5-3-11-21-23-20(31)22-17-7-9-18(10-8-17)32(28,29)24-12-14-30-15-13-24/h1-11H,12-15H2,(H2,22,23,31) |
| InChIK | LYNRREBRTRKFQU-UHFFFAOYSA-N |
| TotalMolweight | 475.549 |
| Molweight | 475.549 |
| MonoisotopicMass | 475.09841 |
| CLogP | 1.7317 |
| CLogS | -4.279 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 354 |
| Relative PSA | 0.3813 |
| PolarSurfaceArea | 169.32 |
| Druglikeness | -2.4664 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea | 2 - 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea