| MolName | N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| MolecularFormula | C29H22N3O3Cl |
| Smiles | O=C(CN(c1c2cccc1)c(cccc1)c1C2=O)N/N=C\c1cccc(OCc(cc2)ccc2Cl)c1 |
| InChI | InChI=1S/C29H22ClN3O3/c30-22-14-12-20(13-15-22)19-36-23-7-5-6-21(16-23)17-31-32-28(34)18-33-26-10-3-1-8-24(26)29(35)25-9-2-4-11-27(25)33/h1-17H,18-19H2,(H,32,34) |
| InChIK | LZFFRNGNFPHQNL-UHFFFAOYSA-N |
| TotalMolweight | 495.965 |
| Molweight | 495.965 |
| MonoisotopicMass | 495.134969 |
| CLogP | 6.262 |
| CLogS | -8.63 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 374 |
| Relative PSA | 0.16738 |
| PolarSurfaceArea | 71 |
| Druglikeness | 5.9349 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 8 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide | 2 - N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide