| MolName | 3-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| MolecularFormula | C22H15N2O2Cl2F3 |
| Smiles | O=C(c1cccc(OCc(ccc(Cl)c2)c2Cl)c1)N/N=C\c1cc(C(F)(F)F)ccc1 |
| InChI | InChI=1S/C22H15Cl2F3N2O2/c23-18-8-7-16(20(24)11-18)13-31-19-6-2-4-15(10-19)21(30)29-28-12-14-3-1-5-17(9-14)22(25,26)27/h1-12H,13H2,(H,29,30) |
| InChIK | LZHWLEUXVCKYTE-UHFFFAOYSA-N |
| TotalMolweight | 467.273 |
| Molweight | 467.273 |
| MonoisotopicMass | 466.046266 |
| CLogP | 6.61 |
| CLogS | -7.312 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 330.81 |
| Relative PSA | 0.13908 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | -3.1386 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]benzamide | 2 - 3-[(2,4-dichlorophenyl)methoxy]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]benzamide