| MolName | [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-6-bromo-4-nitrophenyl] benzoate |
| MolecularFormula | C31H21N4O8Br |
| Smiles | [O-][N+](c(cc1/C=N\NC(/C(/NC(c2ccccc2)=O)=C/c(cc2)cc3c2OCO3)=O)cc(Br)c1OC(c1ccccc1)=O)=O |
| InChI | InChI=1S/C31H21BrN4O8/c32-24-16-23(36(40)41)15-22(28(24)44-31(39)21-9-5-2-6-10-21)17-33-35-30(38)25(34-29(37)20-7-3-1-4-8-20)13-19-11-12-26-27(14-19)43-18-42-26/h1-17H,18H2,(H,34,37)(H,35,38) |
| InChIK | LZJATJHPUCKPNE-UHFFFAOYSA-N |
| TotalMolweight | 657.432 |
| Molweight | 657.432 |
| MonoisotopicMass | 656.054277 |
| CLogP | 6.1638 |
| CLogS | -8.941 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 450.74 |
| Relative PSA | 0.29722 |
| PolarSurfaceArea | 161.14 |
| Druglikeness | -0.70298 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43182 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-6-bromo-4-nitrophenyl] benzoate | 2 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-6-bromo-4-nitrophenyl] benzoate