| MolName | 5-(1-adamantyl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
| MolecularFormula | C21H23N4OF |
| Smiles | O=C(c1n[nH]c(C2(CC(C3)C4)CC4CC3C2)c1)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C21H23FN4O/c22-17-3-1-13(2-4-17)12-23-26-20(27)18-8-19(25-24-18)21-9-14-5-15(10-21)7-16(6-14)11-21/h1-4,8,12,14-16H,5-7,9-11H2,(H,24,25)(H,26,27) |
| InChIK | LZSUDFQTXYZVFA-UHFFFAOYSA-N |
| TotalMolweight | 366.439 |
| Molweight | 366.439 |
| MonoisotopicMass | 366.185589 |
| CLogP | 3.4343 |
| CLogS | -5.364 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 271.64 |
| Relative PSA | 0.22445 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 4.8112 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 10 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-(1-adamantyl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-1H-pyrazole-3-carboxamide | 2 - 5-(1-adamantyl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-1H-pyrazole-3-carboxamide