| MolName | N-[(E)-3-(2,4-difluorophenyl)iminoprop-1-enyl]-2,4-difluoroaniline |
| MolecularFormula | C15H10N2F4 |
| Smiles | Fc(cc1)cc(F)c1N/C=C/C=N/c(ccc(F)c1)c1F |
| InChI | InChI=1S/C15H10F4N2/c16-10-2-4-14(12(18)8-10)20-6-1-7-21-15-5-3-11(17)9-13(15)19/h1-9,20H |
| InChIK | LZUKBYXBVILTLB-UHFFFAOYSA-N |
| TotalMolweight | 294.25 |
| Molweight | 294.25 |
| MonoisotopicMass | 294.07801 |
| CLogP | 2.6256 |
| CLogS | -4.652 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 221.14 |
| Relative PSA | 0.10387 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | -1.2308 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-3-(2,4-difluorophenyl)iminoprop-1-enyl]-2,4-difluoroaniline | 2 - N-[(E)-3-(2,4-difluorophenyl)iminoprop-1-enyl]-2,4-difluoroaniline