| MolName | 4-amino-N-[(Z)-[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C20H26N8O4 |
| Smiles | Nc1nonc1C(N/N=C\c(c(N1CCCCC1)c1)cc([N+]([O-])=O)c1N1CCCCC1)=O |
| InChI | InChI=1S/C20H26N8O4/c21-19-18(24-32-25-19)20(29)23-22-13-14-11-17(28(30)31)16(27-9-5-2-6-10-27)12-15(14)26-7-3-1-4-8-26/h11-13H,1-10H2,(H2,21,25)(H,23,29) |
| InChIK | MAKFLEBJAZPJCO-UHFFFAOYSA-N |
| TotalMolweight | 442.478 |
| Molweight | 442.478 |
| MonoisotopicMass | 442.207702 |
| CLogP | 2.1854 |
| CLogS | -5.033 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 337.59 |
| Relative PSA | 0.36983 |
| PolarSurfaceArea | 158.7 |
| Druglikeness | 0.8449 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 13 |
| Symmetricatoms | 4 |
| Amines | 2 |
| Aromatic Amines | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide