| MolName | 1-benzyl-5-[(Z)-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]iminomethyl]-4H-pyridine-3-carbonitrile |
| MolecularFormula | C26H18N5OClS |
| Smiles | N#CC(C1)=CN(Cc2ccccc2)C=C1/C=N\N(C=Nc1c2c(-c(cc3)ccc3Cl)cs1)C2=O |
| InChI | InChI=1S/C26H18ClN5OS/c27-22-8-6-21(7-9-22)23-16-34-25-24(23)26(33)32(17-29-25)30-12-20-10-19(11-28)14-31(15-20)13-18-4-2-1-3-5-18/h1-9,12,14-17H,10,13H2 |
| InChIK | MAVWYNBFHHVGDX-UHFFFAOYSA-N |
| TotalMolweight | 483.982 |
| Molweight | 483.982 |
| MonoisotopicMass | 483.092057 |
| CLogP | 3.9858 |
| CLogS | -7.369 |
| H Acceptors | 6 |
| TotalSurfaceArea | 363.66 |
| Relative PSA | 0.21196 |
| PolarSurfaceArea | 100.3 |
| Druglikeness | 2.5714 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-benzyl-5-[(Z)-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]iminomethyl]-4H-pyridine-3-carbonitrile | 2 - 1-benzyl-5-[(Z)-[5-(4-chlorophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]iminomethyl]-4H-pyridine-3-carbonitrile